C25H26BrN3O2S — CID 10697084
ethyl 4-[4-[(E)-2-(3-prop-2-ynyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]phenyl]piperazine-1-carboxylate bromide (PubChem CID 10697084) has the molecular formula C25H26BrN3O2S and a molecular weight of 512.47 g/mol. Its IUPAC name is ethyl 4-[4-[(E)-2-(3-prop-2-ynyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]phenyl]piperazine-1-carboxylate bromide.
| Compound Name | ethyl 4-[4-[(E)-2-(3-prop-2-ynyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]phenyl]piperazine-1-carboxylate bromide |
|---|---|
| PubChem CID | 10697084 |
| Molecular Formula | C25H26BrN3O2S |
| Molecular Weight | 512.47 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | ethyl 4-[4-[(E)-2-(3-prop-2-ynyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]phenyl]piperazine-1-carboxylate bromide |
| SMILES | C#CC[n+]1c(/C=C/c2ccc(N3CCN(C(=O)OCC)CC3)cc2)sc2ccccc21.[Br-] |
| InChI | InChI=1S/C25H26N3O2S.BrH/c1-3-15-28-22-7-5-6-8-23(22)31-24(28)14-11-20-9-12-21(13-10-20)26-16-18-27(19-17-26)25(29)30-4-2;/h1,5-14H,4,15-19H2,2H3;1H/q+1;/p-1 |
| InChIKey | KETLJRZOBWVZSB-UHFFFAOYSA-M |
| XLogP | 1.27 |
| TPSA | 36.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.47 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|