C22H22N4O4S — CID 74380615
1,3-benzothiazol-2-ylmethyl 4-[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]piperazine-1-carboxylate (PubChem CID 74380615) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 4-[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]piperazine-1-carboxylate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 4-[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 74380615 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 4-[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]piperazine-1-carboxylate |
| SMILES | O=C(C=Cc1ccc(N2CCN(C(=O)OCc3nc4ccccc4s3)CC2)cc1)NO |
| InChI | InChI=1S/C22H22N4O4S/c27-20(24-29)10-7-16-5-8-17(9-6-16)25-11-13-26(14-12-25)22(28)30-15-21-23-18-3-1-2-4-19(18)31-21/h1-10,29H,11-15H2,(H,24,27) |
| InChIKey | SLOZMICNVIKCGO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|