C22H24FN3O5 — CID 24988404
(4-methoxyphenyl)methyl 4-[2-fluoro-4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]piperazine-1-carboxylate (PubChem CID 24988404) has the molecular formula C22H24FN3O5 and a molecular weight of 429.45 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 4-[2-fluoro-4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]piperazine-1-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl 4-[2-fluoro-4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 24988404 |
| Molecular Formula | C22H24FN3O5 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | (4-methoxyphenyl)methyl 4-[2-fluoro-4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]piperazine-1-carboxylate |
| SMILES | COc1ccc(COC(=O)N2CCN(c3ccc(/C=C/C(=O)NO)cc3F)CC2)cc1 |
| InChI | InChI=1S/C22H24FN3O5/c1-30-18-6-2-17(3-7-18)15-31-22(28)26-12-10-25(11-13-26)20-8-4-16(14-19(20)23)5-9-21(27)24-29/h2-9,14,29H,10-13,15H2,1H3,(H,24,27)/b9-5+ |
| InChIKey | ZBXNQFPCXUOOFM-WEVVVXLNSA-N |
| XLogP | 2.81 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|