C20H20BrNO2S — CID 14069439
propan-2-yl 2-[2-[(E)-2-phenylethenyl]-1,3-benzothiazol-3-ium-3-yl]acetate bromide (PubChem CID 14069439) has the molecular formula C20H20BrNO2S and a molecular weight of 418.36 g/mol. Its IUPAC name is propan-2-yl 2-[2-[(E)-2-phenylethenyl]-1,3-benzothiazol-3-ium-3-yl]acetate bromide.
| Compound Name | propan-2-yl 2-[2-[(E)-2-phenylethenyl]-1,3-benzothiazol-3-ium-3-yl]acetate bromide |
|---|---|
| PubChem CID | 14069439 |
| Molecular Formula | C20H20BrNO2S |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | propan-2-yl 2-[2-[(E)-2-phenylethenyl]-1,3-benzothiazol-3-ium-3-yl]acetate bromide |
| SMILES | CC(C)OC(=O)C[n+]1c(/C=C/c2ccccc2)sc2ccccc21.[Br-] |
| InChI | InChI=1S/C20H20NO2S.BrH/c1-15(2)23-20(22)14-21-17-10-6-7-11-18(17)24-19(21)13-12-16-8-4-3-5-9-16;/h3-13,15H,14H2,1-2H3;1H/q+1;/p-1/b13-12+; |
| InChIKey | JZACRPLRVVDKFC-UEIGIMKUSA-M |
| XLogP | 1.31 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|