C29H29IN2S — CID 3050424
3-ethyl-4-(4-phenylphenyl)-2-[2-(4-pyrrolidin-1-ylphenyl)ethenyl]-1,3-thiazol-3-ium iodide (PubChem CID 3050424) has the molecular formula C29H29IN2S and a molecular weight of 564.54 g/mol. Its IUPAC name is 3-ethyl-4-(4-phenylphenyl)-2-[2-(4-pyrrolidin-1-ylphenyl)ethenyl]-1,3-thiazol-3-ium iodide.
| Compound Name | 3-ethyl-4-(4-phenylphenyl)-2-[2-(4-pyrrolidin-1-ylphenyl)ethenyl]-1,3-thiazol-3-ium iodide |
|---|---|
| PubChem CID | 3050424 |
| Molecular Formula | C29H29IN2S |
| Molecular Weight | 564.54 g/mol |
| Exact Mass | 564.11 |
| IUPAC Name | 3-ethyl-4-(4-phenylphenyl)-2-[2-(4-pyrrolidin-1-ylphenyl)ethenyl]-1,3-thiazol-3-ium iodide |
| SMILES | CC[n+]1c(-c2ccc(-c3ccccc3)cc2)csc1C=Cc1ccc(N2CCCC2)cc1.[I-] |
| InChI | InChI=1S/C29H29N2S.HI/c1-2-31-28(26-15-13-25(14-16-26)24-8-4-3-5-9-24)22-32-29(31)19-12-23-10-17-27(18-11-23)30-20-6-7-21-30;/h3-5,8-19,22H,2,6-7,20-21H2,1H3;1H/q+1;/p-1 |
| InChIKey | PHLNJRSJIHEEGV-UHFFFAOYSA-M |
| XLogP | 4.16 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|