C23H27IN2 — CID 78074147
1,3,3-trimethyl-2-[2-(4-pyrrolidin-1-ylphenyl)ethenyl]indol-1-ium iodide (PubChem CID 78074147) has the molecular formula C23H27IN2 and a molecular weight of 458.39 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[2-(4-pyrrolidin-1-ylphenyl)ethenyl]indol-1-ium iodide.
| Compound Name | 1,3,3-trimethyl-2-[2-(4-pyrrolidin-1-ylphenyl)ethenyl]indol-1-ium iodide |
|---|---|
| PubChem CID | 78074147 |
| Molecular Formula | C23H27IN2 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 1,3,3-trimethyl-2-[2-(4-pyrrolidin-1-ylphenyl)ethenyl]indol-1-ium iodide |
| SMILES | C[N+]1=C(C=Cc2ccc(N3CCCC3)cc2)C(C)(C)c2ccccc21.[I-] |
| InChI | InChI=1S/C23H27N2.HI/c1-23(2)20-8-4-5-9-21(20)24(3)22(23)15-12-18-10-13-19(14-11-18)25-16-6-7-17-25;/h4-5,8-15H,6-7,16-17H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | BYUCENOZTGVBAU-UHFFFAOYSA-M |
| XLogP | 2.01 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|