C31H33N4O2+ — CID 123139110
[1,3,3-trimethyl-2-[2-[4-[(4-piperidin-1-ylphenyl)diazenyl]phenyl]ethenyl]indol-1-ium-5-yl] formate (PubChem CID 123139110) has the molecular formula C31H33N4O2+ and a molecular weight of 493.63 g/mol. Its IUPAC name is [1,3,3-trimethyl-2-[2-[4-[(4-piperidin-1-ylphenyl)diazenyl]phenyl]ethenyl]indol-1-ium-5-yl] formate.
| Compound Name | [1,3,3-trimethyl-2-[2-[4-[(4-piperidin-1-ylphenyl)diazenyl]phenyl]ethenyl]indol-1-ium-5-yl] formate |
|---|---|
| PubChem CID | 123139110 |
| Molecular Formula | C31H33N4O2+ |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | [1,3,3-trimethyl-2-[2-[4-[(4-piperidin-1-ylphenyl)diazenyl]phenyl]ethenyl]indol-1-ium-5-yl] formate |
| SMILES | C[N+]1=C(C=Cc2ccc(/N=N/c3ccc(N4CCCCC4)cc3)cc2)C(C)(C)c2cc(OC=O)ccc21 |
| InChI | InChI=1S/C31H33N4O2/c1-31(2)28-21-27(37-22-36)16-17-29(28)34(3)30(31)18-9-23-7-10-24(11-8-23)32-33-25-12-14-26(15-13-25)35-19-5-4-6-20-35/h7-18,21-22H,4-6,19-20H2,1-3H3/q+1 |
| InChIKey | UJACKTBDASJPGT-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 57.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|