C25H29IN2 — CID 178076769
7-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene iodide (PubChem CID 178076769) has the molecular formula C25H29IN2 and a molecular weight of 484.43 g/mol. Its IUPAC name is 7-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene iodide.
| Compound Name | 7-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene iodide |
|---|---|
| PubChem CID | 178076769 |
| Molecular Formula | C25H29IN2 |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 7-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene iodide |
| SMILES | C[N+]1=C(/C=C/c2cc3c4c(c2)CCCN4CCC3)C(C)(C)c2ccccc21.[I-] |
| InChI | InChI=1S/C25H29N2.HI/c1-25(2)21-10-4-5-11-22(21)26(3)23(25)13-12-18-16-19-8-6-14-27-15-7-9-20(17-18)24(19)27;/h4-5,10-13,16-17H,6-9,14-15H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | CNBMJPYQUFBZLO-UHFFFAOYSA-M |
| XLogP | 2.11 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|