C32H29IN2O2 — CID 177251068
1,3,3-trimethyl-2-[2-[4-(N-phenylanilino)phenyl]ethenyl]indol-1-ium-5-carboxylic acid iodide (PubChem CID 177251068) has the molecular formula C32H29IN2O2 and a molecular weight of 600.50 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[2-[4-(N-phenylanilino)phenyl]ethenyl]indol-1-ium-5-carboxylic acid iodide.
| Compound Name | 1,3,3-trimethyl-2-[2-[4-(N-phenylanilino)phenyl]ethenyl]indol-1-ium-5-carboxylic acid iodide |
|---|---|
| PubChem CID | 177251068 |
| Molecular Formula | C32H29IN2O2 |
| Molecular Weight | 600.50 g/mol |
| Exact Mass | 600.13 |
| IUPAC Name | 1,3,3-trimethyl-2-[2-[4-(N-phenylanilino)phenyl]ethenyl]indol-1-ium-5-carboxylic acid iodide |
| SMILES | C[N+]1=C(C=Cc2ccc(N(c3ccccc3)c3ccccc3)cc2)C(C)(C)c2cc(C(=O)O)ccc21.[I-] |
| InChI | InChI=1S/C32H28N2O2.HI/c1-32(2)28-22-24(31(35)36)17-20-29(28)33(3)30(32)21-16-23-14-18-27(19-15-23)34(25-10-6-4-7-11-25)26-12-8-5-9-13-26;/h4-22H,1-3H3;1H |
| InChIKey | AZMZRLAWYXDONC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|