C30H24NO2+ — CID 59595481
1,3,3-trimethyl-2-[(E)-2-pyren-1-ylethenyl]indol-1-ium-5-carboxylic acid (PubChem CID 59595481) has the molecular formula C30H24NO2+ and a molecular weight of 430.53 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(E)-2-pyren-1-ylethenyl]indol-1-ium-5-carboxylic acid.
| Compound Name | 1,3,3-trimethyl-2-[(E)-2-pyren-1-ylethenyl]indol-1-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 59595481 |
| Molecular Formula | C30H24NO2+ |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 1,3,3-trimethyl-2-[(E)-2-pyren-1-ylethenyl]indol-1-ium-5-carboxylic acid |
| SMILES | C[N+]1=C(/C=C/c2ccc3ccc4cccc5ccc2c3c45)C(C)(C)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C30H23NO2/c1-30(2)24-17-22(29(32)33)12-15-25(24)31(3)26(30)16-13-18-7-8-21-10-9-19-5-4-6-20-11-14-23(18)28(21)27(19)20/h4-17H,1-3H3/p+1/b16-13+ |
| InChIKey | AKSSEMDPIJYLJU-DTQAZKPQSA-O |
| XLogP | 7.00 |
| TPSA | 40.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|