C26H24NO2+ — CID 59601850
3-[(E)-2-(1,3-dimethyl-1-prop-2-enylbenzo[e]indol-3-ium-2-yl)ethenyl]benzoic acid (PubChem CID 59601850) has the molecular formula C26H24NO2+ and a molecular weight of 382.48 g/mol. Its IUPAC name is 3-[(E)-2-(1,3-dimethyl-1-prop-2-enylbenzo[e]indol-3-ium-2-yl)ethenyl]benzoic acid.
| Compound Name | 3-[(E)-2-(1,3-dimethyl-1-prop-2-enylbenzo[e]indol-3-ium-2-yl)ethenyl]benzoic acid |
|---|---|
| PubChem CID | 59601850 |
| Molecular Formula | C26H24NO2+ |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 3-[(E)-2-(1,3-dimethyl-1-prop-2-enylbenzo[e]indol-3-ium-2-yl)ethenyl]benzoic acid |
| SMILES | C=CCC1(C)C(/C=C/c2cccc(C(=O)O)c2)=[N+](C)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C26H23NO2/c1-4-16-26(2)23(15-12-18-8-7-10-20(17-18)25(28)29)27(3)22-14-13-19-9-5-6-11-21(19)24(22)26/h4-15,17H,1,16H2,2-3H3/p+1/b15-12+ |
| InChIKey | NIZPWDRITMRTJV-NTCAYCPXSA-O |
| XLogP | 5.81 |
| TPSA | 40.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|