C31H33N2O+ — CID 59010206
N,N-diethyl-4-[(E)-2-[1-(furan-2-ylmethyl)-1,3-dimethylbenzo[e]indol-3-ium-2-yl]ethenyl]aniline (PubChem CID 59010206) has the molecular formula C31H33N2O+ and a molecular weight of 449.62 g/mol. Its IUPAC name is N,N-diethyl-4-[(E)-2-[1-(furan-2-ylmethyl)-1,3-dimethylbenzo[e]indol-3-ium-2-yl]ethenyl]aniline.
| Compound Name | N,N-diethyl-4-[(E)-2-[1-(furan-2-ylmethyl)-1,3-dimethylbenzo[e]indol-3-ium-2-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 59010206 |
| Molecular Formula | C31H33N2O+ |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | N,N-diethyl-4-[(E)-2-[1-(furan-2-ylmethyl)-1,3-dimethylbenzo[e]indol-3-ium-2-yl]ethenyl]aniline |
| SMILES | CCN(CC)c1ccc(/C=C/C2=[N+](C)c3ccc4ccccc4c3C2(C)Cc2ccco2)cc1 |
| InChI | InChI=1S/C31H33N2O/c1-5-33(6-2)25-17-13-23(14-18-25)15-20-29-31(3,22-26-11-9-21-34-26)30-27-12-8-7-10-24(27)16-19-28(30)32(29)4/h7-21H,5-6,22H2,1-4H3/q+1 |
| InChIKey | ZMSZHSPHBRRDLI-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 19.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|