C25H24NO+ — CID 59601852
2-[(E)-2-(1,3-dimethyl-1-prop-2-enylbenzo[e]indol-3-ium-2-yl)ethenyl]phenol (PubChem CID 59601852) has the molecular formula C25H24NO+ and a molecular weight of 354.47 g/mol. Its IUPAC name is 2-[(E)-2-(1,3-dimethyl-1-prop-2-enylbenzo[e]indol-3-ium-2-yl)ethenyl]phenol.
| Compound Name | 2-[(E)-2-(1,3-dimethyl-1-prop-2-enylbenzo[e]indol-3-ium-2-yl)ethenyl]phenol |
|---|---|
| PubChem CID | 59601852 |
| Molecular Formula | C25H24NO+ |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 2-[(E)-2-(1,3-dimethyl-1-prop-2-enylbenzo[e]indol-3-ium-2-yl)ethenyl]phenol |
| SMILES | C=CCC1(C)C(/C=C/c2ccccc2O)=[N+](C)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C25H23NO/c1-4-17-25(2)23(16-14-19-10-6-8-12-22(19)27)26(3)21-15-13-18-9-5-7-11-20(18)24(21)25/h4-16H,1,17H2,2-3H3/p+1 |
| InChIKey | LJVDLAXLOMTHRZ-UHFFFAOYSA-O |
| XLogP | 5.82 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|