C21H21BrN+ — CID 59601826
5-bromo-1,3-dimethyl-2-[(E)-2-phenylethenyl]-3-prop-2-enylindol-1-ium (PubChem CID 59601826) has the molecular formula C21H21BrN+ and a molecular weight of 367.31 g/mol. Its IUPAC name is 5-bromo-1,3-dimethyl-2-[(E)-2-phenylethenyl]-3-prop-2-enylindol-1-ium.
| Compound Name | 5-bromo-1,3-dimethyl-2-[(E)-2-phenylethenyl]-3-prop-2-enylindol-1-ium |
|---|---|
| PubChem CID | 59601826 |
| Molecular Formula | C21H21BrN+ |
| Molecular Weight | 367.31 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 5-bromo-1,3-dimethyl-2-[(E)-2-phenylethenyl]-3-prop-2-enylindol-1-ium |
| SMILES | C=CCC1(C)C(/C=C/c2ccccc2)=[N+](C)c2ccc(Br)cc21 |
| InChI | InChI=1S/C21H21BrN/c1-4-14-21(2)18-15-17(22)11-12-19(18)23(3)20(21)13-10-16-8-6-5-7-9-16/h4-13,15H,1,14H2,2-3H3/q+1/b13-10+ |
| InChIKey | KQZGSGDIBQCUKB-JLHYYAGUSA-N |
| XLogP | 5.72 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.31 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|