C43H45BrFN2+ — CID 90818111
1-[(4-bromo-2-fluorophenyl)methyl]-1,3-dimethyl-2-[3-[1-(3-methylbutyl)-3,3-bis(prop-2-enyl)indol-2-ylidene]prop-1-enyl]benzo[e]indol-3-ium (PubChem CID 90818111) has the molecular formula C43H45BrFN2+ and a molecular weight of 688.75 g/mol. Its IUPAC name is 1-[(4-bromo-2-fluorophenyl)methyl]-1,3-dimethyl-2-[3-[1-(3-methylbutyl)-3,3-bis(prop-2-enyl)indol-2-ylidene]prop-1-enyl]benzo[e]indol-3-ium.
| Compound Name | 1-[(4-bromo-2-fluorophenyl)methyl]-1,3-dimethyl-2-[3-[1-(3-methylbutyl)-3,3-bis(prop-2-enyl)indol-2-ylidene]prop-1-enyl]benzo[e]indol-3-ium |
|---|---|
| PubChem CID | 90818111 |
| Molecular Formula | C43H45BrFN2+ |
| Molecular Weight | 688.75 g/mol |
| Exact Mass | 687.27 |
| IUPAC Name | 1-[(4-bromo-2-fluorophenyl)methyl]-1,3-dimethyl-2-[3-[1-(3-methylbutyl)-3,3-bis(prop-2-enyl)indol-2-ylidene]prop-1-enyl]benzo[e]indol-3-ium |
| SMILES | C=CCC1(CC=C)C(=CC=CC2=[N+](C)c3ccc4ccccc4c3C2(C)Cc2ccc(Br)cc2F)N(CCC(C)C)c2ccccc21 |
| InChI | InChI=1S/C43H45BrFN2/c1-7-25-43(26-8-2)35-16-11-12-17-37(35)47(27-24-30(3)4)40(43)19-13-18-39-42(5,29-32-20-22-33(44)28-36(32)45)41-34-15-10-9-14-31(34)21-23-38(41)46(39)6/h7-23,28,30H,1-2,24-27,29H2,3-6H3/q+1 |
| InChIKey | DIBKOUGFEMELHB-UHFFFAOYSA-N |
| XLogP | 11.37 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.75 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|