C37H44ClN2+ — CID 72531113
2-[3-(5-chloro-3-methyl-3-prop-2-enyl-1-propylindol-2-ylidene)prop-1-enyl]-1,1-dimethyl-3-(3-methylbutyl)benzo[e]indol-3-ium (PubChem CID 72531113) has the molecular formula C37H44ClN2+ and a molecular weight of 552.23 g/mol. Its IUPAC name is 2-[3-(5-chloro-3-methyl-3-prop-2-enyl-1-propylindol-2-ylidene)prop-1-enyl]-1,1-dimethyl-3-(3-methylbutyl)benzo[e]indol-3-ium.
| Compound Name | 2-[3-(5-chloro-3-methyl-3-prop-2-enyl-1-propylindol-2-ylidene)prop-1-enyl]-1,1-dimethyl-3-(3-methylbutyl)benzo[e]indol-3-ium |
|---|---|
| PubChem CID | 72531113 |
| Molecular Formula | C37H44ClN2+ |
| Molecular Weight | 552.23 g/mol |
| Exact Mass | 551.32 |
| IUPAC Name | 2-[3-(5-chloro-3-methyl-3-prop-2-enyl-1-propylindol-2-ylidene)prop-1-enyl]-1,1-dimethyl-3-(3-methylbutyl)benzo[e]indol-3-ium |
| SMILES | C=CCC1(C)C(=CC=CC2=[N+](CCC(C)C)c3ccc4ccccc4c3C2(C)C)N(CCC)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C37H44ClN2/c1-8-22-37(7)30-25-28(38)18-20-31(30)39(23-9-2)34(37)16-12-15-33-36(5,6)35-29-14-11-10-13-27(29)17-19-32(35)40(33)24-21-26(3)4/h8,10-20,25-26H,1,9,21-24H2,2-7H3/q+1 |
| InChIKey | ZDKLMRTYKCSDFB-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.23 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|