C34H39N2+ — CID 72531139
3-ethyl-2-[3-(1-ethyl-3,5-dimethyl-3-prop-2-enylindol-2-ylidene)prop-1-enyl]-1,1-dimethylbenzo[e]indol-3-ium (PubChem CID 72531139) has the molecular formula C34H39N2+ and a molecular weight of 475.70 g/mol. Its IUPAC name is 3-ethyl-2-[3-(1-ethyl-3,5-dimethyl-3-prop-2-enylindol-2-ylidene)prop-1-enyl]-1,1-dimethylbenzo[e]indol-3-ium.
| Compound Name | 3-ethyl-2-[3-(1-ethyl-3,5-dimethyl-3-prop-2-enylindol-2-ylidene)prop-1-enyl]-1,1-dimethylbenzo[e]indol-3-ium |
|---|---|
| PubChem CID | 72531139 |
| Molecular Formula | C34H39N2+ |
| Molecular Weight | 475.70 g/mol |
| Exact Mass | 475.31 |
| IUPAC Name | 3-ethyl-2-[3-(1-ethyl-3,5-dimethyl-3-prop-2-enylindol-2-ylidene)prop-1-enyl]-1,1-dimethylbenzo[e]indol-3-ium |
| SMILES | C=CCC1(C)C(=CC=CC2=[N+](CC)c3ccc4ccccc4c3C2(C)C)N(CC)c2ccc(C)cc21 |
| InChI | InChI=1S/C34H39N2/c1-8-22-34(7)27-23-24(4)18-20-28(27)35(9-2)31(34)17-13-16-30-33(5,6)32-26-15-12-11-14-25(26)19-21-29(32)36(30)10-3/h8,11-21,23H,1,9-10,22H2,2-7H3/q+1 |
| InChIKey | IETCNXZZPILRFN-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.70 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|