C34H37N2O+ — CID 54340368
2-[3-(5-methoxy-3,3-dimethyl-1-prop-2-enylindol-2-ylidene)prop-1-enyl]-1,1-dimethyl-3-prop-2-enylbenzo[e]indol-3-ium (PubChem CID 54340368) has the molecular formula C34H37N2O+ and a molecular weight of 489.68 g/mol. Its IUPAC name is 2-[3-(5-methoxy-3,3-dimethyl-1-prop-2-enylindol-2-ylidene)prop-1-enyl]-1,1-dimethyl-3-prop-2-enylbenzo[e]indol-3-ium.
| Compound Name | 2-[3-(5-methoxy-3,3-dimethyl-1-prop-2-enylindol-2-ylidene)prop-1-enyl]-1,1-dimethyl-3-prop-2-enylbenzo[e]indol-3-ium |
|---|---|
| PubChem CID | 54340368 |
| Molecular Formula | C34H37N2O+ |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | 2-[3-(5-methoxy-3,3-dimethyl-1-prop-2-enylindol-2-ylidene)prop-1-enyl]-1,1-dimethyl-3-prop-2-enylbenzo[e]indol-3-ium |
| SMILES | C=CCN1C(=CC=CC2=[N+](CC=C)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2cc(OC)ccc21 |
| InChI | InChI=1S/C34H37N2O/c1-8-21-35-28-20-18-25(37-7)23-27(28)33(3,4)30(35)15-12-16-31-34(5,6)32-26-14-11-10-13-24(26)17-19-29(32)36(31)22-9-2/h8-20,23H,1-2,21-22H2,3-7H3/q+1 |
| InChIKey | TYMUETXKWQSIEX-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|