C31H33N2O6S2+ — CID 72530923
2-[5-[3,3-dimethyl-1-(trioxidanylsulfanylmethyl)indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethyl-3-(trioxidanylsulfanylmethyl)benzo[e]indol-3-ium (PubChem CID 72530923) has the molecular formula C31H33N2O6S2+ and a molecular weight of 593.75 g/mol. Its IUPAC name is 2-[5-[3,3-dimethyl-1-(trioxidanylsulfanylmethyl)indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethyl-3-(trioxidanylsulfanylmethyl)benzo[e]indol-3-ium.
| Compound Name | 2-[5-[3,3-dimethyl-1-(trioxidanylsulfanylmethyl)indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethyl-3-(trioxidanylsulfanylmethyl)benzo[e]indol-3-ium |
|---|---|
| PubChem CID | 72530923 |
| Molecular Formula | C31H33N2O6S2+ |
| Molecular Weight | 593.75 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | 2-[5-[3,3-dimethyl-1-(trioxidanylsulfanylmethyl)indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethyl-3-(trioxidanylsulfanylmethyl)benzo[e]indol-3-ium |
| SMILES | CC1(C)C(=CC=CC=CC2=[N+](CSOOO)c3ccc4ccccc4c3C2(C)C)N(CSOOO)c2ccccc21 |
| InChI | InChI=1S/C31H32N2O6S2/c1-30(2)24-14-10-11-15-25(24)32(20-40-38-36-34)27(30)16-6-5-7-17-28-31(3,4)29-23-13-9-8-12-22(23)18-19-26(29)33(28)21-41-39-37-35/h5-19H,20-21H2,1-4H3,(H-,34,35)/p+1 |
| InChIKey | OCODBGPEAHPKKV-UHFFFAOYSA-O |
| XLogP | 8.06 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.75 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|