C45H53N2+ — CID 76689767
2-[7-[1,1-dimethyl-3-(3-methylbutyl)benzo[e]indol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,1-dimethyl-3-(3-methylbutyl)benzo[e]indole (PubChem CID 76689767) has the molecular formula C45H53N2+ and a molecular weight of 621.93 g/mol. Its IUPAC name is 2-[7-[1,1-dimethyl-3-(3-methylbutyl)benzo[e]indol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,1-dimethyl-3-(3-methylbutyl)benzo[e]indole.
| Compound Name | 2-[7-[1,1-dimethyl-3-(3-methylbutyl)benzo[e]indol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,1-dimethyl-3-(3-methylbutyl)benzo[e]indole |
|---|---|
| PubChem CID | 76689767 |
| Molecular Formula | C45H53N2+ |
| Molecular Weight | 621.93 g/mol |
| Exact Mass | 621.42 |
| IUPAC Name | 2-[7-[1,1-dimethyl-3-(3-methylbutyl)benzo[e]indol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,1-dimethyl-3-(3-methylbutyl)benzo[e]indole |
| SMILES | CC(C)CCN1C(=CC=CC=CC=CC2=[N+](CCC(C)C)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C45H53N2/c1-32(2)28-30-46-38-26-24-34-18-14-16-20-36(34)42(38)44(5,6)40(46)22-12-10-9-11-13-23-41-45(7,8)43-37-21-17-15-19-35(37)25-27-39(43)47(41)31-29-33(3)4/h9-27,32-33H,28-31H2,1-8H3/q+1 |
| InChIKey | LMCFETYNXOIERH-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.93 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|