C35H33N2O6S2- — CID 58648831
[2-[5-[1,1-dimethyl-3-(sulfonatomethyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1,1-dimethylbenzo[e]indol-3-yl]methanesulfonate (PubChem CID 58648831) has the molecular formula C35H33N2O6S2- and a molecular weight of 641.79 g/mol. Its IUPAC name is [2-[5-[1,1-dimethyl-3-(sulfonatomethyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1,1-dimethylbenzo[e]indol-3-yl]methanesulfonate.
| Compound Name | [2-[5-[1,1-dimethyl-3-(sulfonatomethyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1,1-dimethylbenzo[e]indol-3-yl]methanesulfonate |
|---|---|
| PubChem CID | 58648831 |
| Molecular Formula | C35H33N2O6S2- |
| Molecular Weight | 641.79 g/mol |
| Exact Mass | 641.18 |
| IUPAC Name | [2-[5-[1,1-dimethyl-3-(sulfonatomethyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1,1-dimethylbenzo[e]indol-3-yl]methanesulfonate |
| SMILES | CC1(C)C(=CC=CC=CC2=[N+](CS(=O)(=O)[O-])c3ccc4ccccc4c3C2(C)C)N(CS(=O)(=O)[O-])c2ccc3ccccc3c21 |
| InChI | InChI=1S/C35H34N2O6S2/c1-34(2)30(36(22-44(38,39)40)28-20-18-24-12-8-10-14-26(24)32(28)34)16-6-5-7-17-31-35(3,4)33-27-15-11-9-13-25(27)19-21-29(33)37(31)23-45(41,42)43/h5-21H,22-23H2,1-4H3,(H-,38,39,40,41,42,43)/p-1 |
| InChIKey | IAEPIFQMHBBKKI-UHFFFAOYSA-M |
| XLogP | 6.17 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.79 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|