C44H49N2O2+ — CID 72526393
3-[2-[3-[3-(3-cyclopentylpropyl)-1-methyl-1-prop-2-enylbenzo[e]indol-2-ylidene]prop-1-enyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]propanoic acid (PubChem CID 72526393) has the molecular formula C44H49N2O2+ and a molecular weight of 637.89 g/mol. Its IUPAC name is 3-[2-[3-[3-(3-cyclopentylpropyl)-1-methyl-1-prop-2-enylbenzo[e]indol-2-ylidene]prop-1-enyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]propanoic acid.
| Compound Name | 3-[2-[3-[3-(3-cyclopentylpropyl)-1-methyl-1-prop-2-enylbenzo[e]indol-2-ylidene]prop-1-enyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]propanoic acid |
|---|---|
| PubChem CID | 72526393 |
| Molecular Formula | C44H49N2O2+ |
| Molecular Weight | 637.89 g/mol |
| Exact Mass | 637.38 |
| IUPAC Name | 3-[2-[3-[3-(3-cyclopentylpropyl)-1-methyl-1-prop-2-enylbenzo[e]indol-2-ylidene]prop-1-enyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]propanoic acid |
| SMILES | C=CCC1(C)C(=CC=CC2=[N+](CCC(=O)O)c3ccc4ccccc4c3C2(C)C)N(CCCC2CCCC2)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C44H48N2O2/c1-5-28-44(4)39(45(29-13-16-31-14-6-7-15-31)37-26-24-33-18-9-11-20-35(33)42(37)44)22-12-21-38-43(2,3)41-34-19-10-8-17-32(34)23-25-36(41)46(38)30-27-40(47)48/h5,8-12,17-26,31H,1,6-7,13-16,27-30H2,2-4H3/p+1 |
| InChIKey | QOHMFJZYCAGINR-UHFFFAOYSA-O |
| XLogP | 10.61 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.89 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|