C52H65N2+ — CID 59006066
(2E)-1-[(E)-but-2-enyl]-3-(4-cyclopentylbutyl)-2-[(E)-3-[3-(4-cyclopentylbutyl)-1,1-dimethylbenzo[e]indol-3-ium-2-yl]prop-2-enylidene]-1-methylbenzo[e]indole (PubChem CID 59006066) has the molecular formula C52H65N2+ and a molecular weight of 718.11 g/mol. Its IUPAC name is (2E)-1-[(E)-but-2-enyl]-3-(4-cyclopentylbutyl)-2-[(E)-3-[3-(4-cyclopentylbutyl)-1,1-dimethylbenzo[e]indol-3-ium-2-yl]prop-2-enylidene]-1-methylbenzo[e]indole.
| Compound Name | (2E)-1-[(E)-but-2-enyl]-3-(4-cyclopentylbutyl)-2-[(E)-3-[3-(4-cyclopentylbutyl)-1,1-dimethylbenzo[e]indol-3-ium-2-yl]prop-2-enylidene]-1-methylbenzo[e]indole |
|---|---|
| PubChem CID | 59006066 |
| Molecular Formula | C52H65N2+ |
| Molecular Weight | 718.11 g/mol |
| Exact Mass | 717.51 |
| IUPAC Name | (2E)-1-[(E)-but-2-enyl]-3-(4-cyclopentylbutyl)-2-[(E)-3-[3-(4-cyclopentylbutyl)-1,1-dimethylbenzo[e]indol-3-ium-2-yl]prop-2-enylidene]-1-methylbenzo[e]indole |
| SMILES | C/C=C/CC1(C)/C(=C\C=C\C2=[N+](CCCCC3CCCC3)c3ccc4ccccc4c3C2(C)C)N(CCCCC2CCCC2)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C52H65N2/c1-5-6-36-52(4)48(54(38-18-16-25-40-22-9-10-23-40)46-35-33-42-27-12-14-29-44(42)50(46)52)31-19-30-47-51(2,3)49-43-28-13-11-26-41(43)32-34-45(49)53(47)37-17-15-24-39-20-7-8-21-39/h5-6,11-14,19,26-35,39-40H,7-10,15-18,20-25,36-38H2,1-4H3/q+1/b6-5+ |
| InChIKey | OQFYZRNUPSGTKI-AATRIKPKSA-N |
| XLogP | 14.27 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.11 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|