C41H43N2O6S2+ — CID 121355382
2-[(2Z)-1-methyl-2-[(2E,4E)-5-[1-methyl-1-prop-2-enyl-3-(2-sulfoethyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1-prop-2-enylbenzo[e]indol-3-yl]ethanesulfonic acid (PubChem CID 121355382) has the molecular formula C41H43N2O6S2+ and a molecular weight of 723.94 g/mol. Its IUPAC name is 2-[(2Z)-1-methyl-2-[(2E,4E)-5-[1-methyl-1-prop-2-enyl-3-(2-sulfoethyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1-prop-2-enylbenzo[e]indol-3-yl]ethanesulfonic acid.
| Compound Name | 2-[(2Z)-1-methyl-2-[(2E,4E)-5-[1-methyl-1-prop-2-enyl-3-(2-sulfoethyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1-prop-2-enylbenzo[e]indol-3-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 121355382 |
| Molecular Formula | C41H43N2O6S2+ |
| Molecular Weight | 723.94 g/mol |
| Exact Mass | 723.26 |
| IUPAC Name | 2-[(2Z)-1-methyl-2-[(2E,4E)-5-[1-methyl-1-prop-2-enyl-3-(2-sulfoethyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1-prop-2-enylbenzo[e]indol-3-yl]ethanesulfonic acid |
| SMILES | C=CCC1(C)C(/C=C/C=C/C=C2\N(CCS(=O)(=O)O)c3ccc4ccccc4c3C2(C)CC=C)=[N+](CCS(=O)(=O)O)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C41H42N2O6S2/c1-5-24-40(3)36(42(26-28-50(44,45)46)34-22-20-30-14-10-12-16-32(30)38(34)40)18-8-7-9-19-37-41(4,25-6-2)39-33-17-13-11-15-31(33)21-23-35(39)43(37)27-29-51(47,48)49/h5-23H,1-2,24-29H2,3-4H3,(H-,44,45,46,47,48,49)/p+1 |
| InChIKey | KPMINKRJNSKCNE-UHFFFAOYSA-O |
| XLogP | 8.05 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.94 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|