C32H31N2O7S2+ — CID 76681209
2-[1-methyl-1-prop-2-enyl-2-[[3-(2-sulfoethyl)benzo[g][1,3]benzoxazol-3-ium-2-yl]methylidene]benzo[e]indol-3-yl]ethanesulfonic acid (PubChem CID 76681209) has the molecular formula C32H31N2O7S2+ and a molecular weight of 619.74 g/mol. Its IUPAC name is 2-[1-methyl-1-prop-2-enyl-2-[[3-(2-sulfoethyl)benzo[g][1,3]benzoxazol-3-ium-2-yl]methylidene]benzo[e]indol-3-yl]ethanesulfonic acid.
| Compound Name | 2-[1-methyl-1-prop-2-enyl-2-[[3-(2-sulfoethyl)benzo[g][1,3]benzoxazol-3-ium-2-yl]methylidene]benzo[e]indol-3-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 76681209 |
| Molecular Formula | C32H31N2O7S2+ |
| Molecular Weight | 619.74 g/mol |
| Exact Mass | 619.16 |
| IUPAC Name | 2-[1-methyl-1-prop-2-enyl-2-[[3-(2-sulfoethyl)benzo[g][1,3]benzoxazol-3-ium-2-yl]methylidene]benzo[e]indol-3-yl]ethanesulfonic acid |
| SMILES | C=CCC1(C)C(=Cc2oc3c4ccccc4ccc3[n+]2CCS(=O)(=O)O)N(CCS(=O)(=O)O)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C32H30N2O7S2/c1-3-16-32(2)28(33(17-19-42(35,36)37)26-14-12-22-8-4-6-10-24(22)30(26)32)21-29-34(18-20-43(38,39)40)27-15-13-23-9-5-7-11-25(23)31(27)41-29/h3-15,21H,1,16-20H2,2H3,(H-,35,36,37,38,39,40)/p+1 |
| InChIKey | ZTXYRRGCAXXCJS-UHFFFAOYSA-O |
| XLogP | 5.50 |
| TPSA | 129.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.74 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|