C41H37F2N2+ — CID 91475183
1-[(2,4-difluorophenyl)methyl]-2-[3-(1,3-dimethyl-1-prop-2-enylbenzo[e]indol-2-ylidene)prop-1-enyl]-1,3-dimethylbenzo[e]indol-3-ium (PubChem CID 91475183) has the molecular formula C41H37F2N2+ and a molecular weight of 595.76 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-2-[3-(1,3-dimethyl-1-prop-2-enylbenzo[e]indol-2-ylidene)prop-1-enyl]-1,3-dimethylbenzo[e]indol-3-ium.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-2-[3-(1,3-dimethyl-1-prop-2-enylbenzo[e]indol-2-ylidene)prop-1-enyl]-1,3-dimethylbenzo[e]indol-3-ium |
|---|---|
| PubChem CID | 91475183 |
| Molecular Formula | C41H37F2N2+ |
| Molecular Weight | 595.76 g/mol |
| Exact Mass | 595.29 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-2-[3-(1,3-dimethyl-1-prop-2-enylbenzo[e]indol-2-ylidene)prop-1-enyl]-1,3-dimethylbenzo[e]indol-3-ium |
| SMILES | C=CCC1(C)C(=CC=CC2=[N+](C)c3ccc4ccccc4c3C2(C)Cc2ccc(F)cc2F)N(C)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C41H37F2N2/c1-6-24-40(2)36(44(4)34-22-19-27-12-7-9-14-31(27)38(34)40)16-11-17-37-41(3,26-29-18-21-30(42)25-33(29)43)39-32-15-10-8-13-28(32)20-23-35(39)45(37)5/h6-23,25H,1,24,26H2,2-5H3/q+1 |
| InChIKey | FUXCSGMORBIORG-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.76 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|