C19H19N2O2S+ — CID 76746237
1,3-dimethyl-5-nitro-3-prop-2-enyl-2-(2-thiophen-2-ylethenyl)indol-1-ium (PubChem CID 76746237) has the molecular formula C19H19N2O2S+ and a molecular weight of 339.44 g/mol. Its IUPAC name is 1,3-dimethyl-5-nitro-3-prop-2-enyl-2-(2-thiophen-2-ylethenyl)indol-1-ium.
| Compound Name | 1,3-dimethyl-5-nitro-3-prop-2-enyl-2-(2-thiophen-2-ylethenyl)indol-1-ium |
|---|---|
| PubChem CID | 76746237 |
| Molecular Formula | C19H19N2O2S+ |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1,3-dimethyl-5-nitro-3-prop-2-enyl-2-(2-thiophen-2-ylethenyl)indol-1-ium |
| SMILES | C=CCC1(C)C(C=Cc2cccs2)=[N+](C)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C19H19N2O2S/c1-4-11-19(2)16-13-14(21(22)23)7-9-17(16)20(3)18(19)10-8-15-6-5-12-24-15/h4-10,12-13H,1,11H2,2-3H3/q+1 |
| InChIKey | CHMSVHPRNXZHIC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|