C23H30N3O2S+ — CID 59920075
N,N-dipropyl-5-[2-(1,3,3-trimethyl-5-nitroindol-1-ium-2-yl)ethenyl]thiophen-2-amine (PubChem CID 59920075) has the molecular formula C23H30N3O2S+ and a molecular weight of 412.58 g/mol. Its IUPAC name is N,N-dipropyl-5-[2-(1,3,3-trimethyl-5-nitroindol-1-ium-2-yl)ethenyl]thiophen-2-amine.
| Compound Name | N,N-dipropyl-5-[2-(1,3,3-trimethyl-5-nitroindol-1-ium-2-yl)ethenyl]thiophen-2-amine |
|---|---|
| PubChem CID | 59920075 |
| Molecular Formula | C23H30N3O2S+ |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | N,N-dipropyl-5-[2-(1,3,3-trimethyl-5-nitroindol-1-ium-2-yl)ethenyl]thiophen-2-amine |
| SMILES | CCCN(CCC)c1ccc(C=CC2=[N+](C)c3ccc([N+](=O)[O-])cc3C2(C)C)s1 |
| InChI | InChI=1S/C23H30N3O2S/c1-6-14-25(15-7-2)22-13-10-18(29-22)9-12-21-23(3,4)19-16-17(26(27)28)8-11-20(19)24(21)5/h8-13,16H,6-7,14-15H2,1-5H3/q+1 |
| InChIKey | KLWOIKQYQIGIMM-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|