C33H36IN4O4+ — CID 173495851
2-[2-[2-(iodomethyl)-3-[2-(1,3,3-trimethyl-5-nitroindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-1,3,3-trimethyl-5-nitroindole (PubChem CID 173495851) has the molecular formula C33H36IN4O4+ and a molecular weight of 679.58 g/mol. Its IUPAC name is 2-[2-[2-(iodomethyl)-3-[2-(1,3,3-trimethyl-5-nitroindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-1,3,3-trimethyl-5-nitroindole.
| Compound Name | 2-[2-[2-(iodomethyl)-3-[2-(1,3,3-trimethyl-5-nitroindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-1,3,3-trimethyl-5-nitroindole |
|---|---|
| PubChem CID | 173495851 |
| Molecular Formula | C33H36IN4O4+ |
| Molecular Weight | 679.58 g/mol |
| Exact Mass | 679.18 |
| IUPAC Name | 2-[2-[2-(iodomethyl)-3-[2-(1,3,3-trimethyl-5-nitroindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-1,3,3-trimethyl-5-nitroindole |
| SMILES | CN1C(=CC=C2CCCC(C=CC3=[N+](C)c4ccc([N+](=O)[O-])cc4C3(C)C)=C2CI)C(C)(C)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C33H36IN4O4/c1-32(2)26-18-23(37(39)40)12-14-28(26)35(5)30(32)16-10-21-8-7-9-22(25(21)20-34)11-17-31-33(3,4)27-19-24(38(41)42)13-15-29(27)36(31)6/h10-19H,7-9,20H2,1-6H3/q+1 |
| InChIKey | ZSQKIWKRIAELBG-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 92.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.58 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|