C37H47BrN2O5S — CID 91869495
2-[2-[2-bromo-3-[2-(5-methoxy-1,3,3,6-tetramethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-5-methoxy-1,3,3,6-tetramethylindole;methanesulfonate (PubChem CID 91869495) has the molecular formula C37H47BrN2O5S and a molecular weight of 711.76 g/mol. Its IUPAC name is 2-[2-[2-bromo-3-[2-(5-methoxy-1,3,3,6-tetramethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-5-methoxy-1,3,3,6-tetramethylindole;methanesulfonate.
| Compound Name | 2-[2-[2-bromo-3-[2-(5-methoxy-1,3,3,6-tetramethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-5-methoxy-1,3,3,6-tetramethylindole;methanesulfonate |
|---|---|
| PubChem CID | 91869495 |
| Molecular Formula | C37H47BrN2O5S |
| Molecular Weight | 711.76 g/mol |
| Exact Mass | 710.24 |
| IUPAC Name | 2-[2-[2-bromo-3-[2-(5-methoxy-1,3,3,6-tetramethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-5-methoxy-1,3,3,6-tetramethylindole;methanesulfonate |
| SMILES | COc1cc2c(cc1C)N(C)C(=CC=C1CCCC(C=CC3=[N+](C)c4cc(C)c(OC)cc4C3(C)C)=C1Br)C2(C)C.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C36H44BrN2O2.CH4O3S/c1-22-18-28-26(20-30(22)40-9)35(3,4)32(38(28)7)16-14-24-12-11-13-25(34(24)37)15-17-33-36(5,6)27-21-31(41-10)23(2)19-29(27)39(33)8;1-5(2,3)4/h14-21H,11-13H2,1-10H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | ARIJGBPVRGDBBE-UHFFFAOYSA-M |
| XLogP | 8.12 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.76 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|