C37H47ClN2O7S — CID 91055875
(2Z)-2-[2-[2-chloro-3-[(E)-2-(5,6-dimethoxy-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-5,6-dimethoxy-1,3,3-trimethylindole;methanesulfonate (PubChem CID 91055875) has the molecular formula C37H47ClN2O7S and a molecular weight of 699.31 g/mol. Its IUPAC name is (2Z)-2-[2-[2-chloro-3-[(E)-2-(5,6-dimethoxy-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-5,6-dimethoxy-1,3,3-trimethylindole;methanesulfonate.
| Compound Name | (2Z)-2-[2-[2-chloro-3-[(E)-2-(5,6-dimethoxy-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-5,6-dimethoxy-1,3,3-trimethylindole;methanesulfonate |
|---|---|
| PubChem CID | 91055875 |
| Molecular Formula | C37H47ClN2O7S |
| Molecular Weight | 699.31 g/mol |
| Exact Mass | 698.28 |
| IUPAC Name | (2Z)-2-[2-[2-chloro-3-[(E)-2-(5,6-dimethoxy-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-5,6-dimethoxy-1,3,3-trimethylindole;methanesulfonate |
| SMILES | COc1cc2c(cc1OC)C(C)(C)/C(=C/C=C1CCCC(/C=C/C3=[N+](C)c4cc(OC)c(OC)cc4C3(C)C)=C1Cl)N2C.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C36H44ClN2O4.CH4O3S/c1-35(2)24-18-28(40-7)30(42-9)20-26(24)38(5)32(35)16-14-22-12-11-13-23(34(22)37)15-17-33-36(3,4)25-19-29(41-8)31(43-10)21-27(25)39(33)6;1-5(2,3)4/h14-21H,11-13H2,1-10H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | WFZGBTCFYSQZDB-UHFFFAOYSA-M |
| XLogP | 7.36 |
| TPSA | 100.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.31 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|