C36H44ClN2O4+ — CID 76609812
[2-[2-[2-chloro-3-[2-(5,6-dimethoxy-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-5-methoxy-1,3,3-trimethylindol-6-yl]methanol (PubChem CID 76609812) has the molecular formula C36H44ClN2O4+ and a molecular weight of 604.21 g/mol. Its IUPAC name is [2-[2-[2-chloro-3-[2-(5,6-dimethoxy-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-5-methoxy-1,3,3-trimethylindol-6-yl]methanol.
| Compound Name | [2-[2-[2-chloro-3-[2-(5,6-dimethoxy-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-5-methoxy-1,3,3-trimethylindol-6-yl]methanol |
|---|---|
| PubChem CID | 76609812 |
| Molecular Formula | C36H44ClN2O4+ |
| Molecular Weight | 604.21 g/mol |
| Exact Mass | 603.30 |
| IUPAC Name | [2-[2-[2-chloro-3-[2-(5,6-dimethoxy-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-5-methoxy-1,3,3-trimethylindol-6-yl]methanol |
| SMILES | COc1cc2c(cc1CO)N(C)C(=CC=C1CCCC(C=CC3=[N+](C)c4cc(OC)c(OC)cc4C3(C)C)=C1Cl)C2(C)C |
| InChI | InChI=1S/C36H44ClN2O4/c1-35(2)25-18-29(41-7)24(21-40)17-27(25)38(5)32(35)15-13-22-11-10-12-23(34(22)37)14-16-33-36(3,4)26-19-30(42-8)31(43-9)20-28(26)39(33)6/h13-20,40H,10-12,21H2,1-9H3/q+1 |
| InChIKey | ZENNBNVYRNDUIQ-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 54.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.21 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|