C37H47ClN2O5 — CID 72573633
2-[2-[2-chloro-3-[2-(5,6-dimethoxy-1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-2,5,6-trimethoxy-1,3,3-trimethylindole (PubChem CID 72573633) has the molecular formula C37H47ClN2O5 and a molecular weight of 635.25 g/mol. Its IUPAC name is 2-[2-[2-chloro-3-[2-(5,6-dimethoxy-1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-2,5,6-trimethoxy-1,3,3-trimethylindole.
| Compound Name | 2-[2-[2-chloro-3-[2-(5,6-dimethoxy-1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-2,5,6-trimethoxy-1,3,3-trimethylindole |
|---|---|
| PubChem CID | 72573633 |
| Molecular Formula | C37H47ClN2O5 |
| Molecular Weight | 635.25 g/mol |
| Exact Mass | 634.32 |
| IUPAC Name | 2-[2-[2-chloro-3-[2-(5,6-dimethoxy-1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-2,5,6-trimethoxy-1,3,3-trimethylindole |
| SMILES | COc1cc2c(cc1OC)C(C)(C)C(=CC=C1CCCC(C=CC3(OC)N(C)c4cc(OC)c(OC)cc4C3(C)C)=C1Cl)N2C |
| InChI | InChI=1S/C37H47ClN2O5/c1-35(2)25-19-29(41-7)31(43-9)21-27(25)39(5)33(35)16-15-23-13-12-14-24(34(23)38)17-18-37(45-11)36(3,4)26-20-30(42-8)32(44-10)22-28(26)40(37)6/h15-22H,12-14H2,1-11H3 |
| InChIKey | XKMFSVLVLYHPEB-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 52.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.25 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|