C41H55ClN2O3 — CID 72573641
5-butoxy-2-[2-[3-[2-(5-butoxy-1,3,3-trimethylindol-2-ylidene)ethylidene]-2-chlorocyclohexen-1-yl]ethenyl]-2-methoxy-1,3,3-trimethylindole (PubChem CID 72573641) has the molecular formula C41H55ClN2O3 and a molecular weight of 659.36 g/mol. Its IUPAC name is 5-butoxy-2-[2-[3-[2-(5-butoxy-1,3,3-trimethylindol-2-ylidene)ethylidene]-2-chlorocyclohexen-1-yl]ethenyl]-2-methoxy-1,3,3-trimethylindole.
| Compound Name | 5-butoxy-2-[2-[3-[2-(5-butoxy-1,3,3-trimethylindol-2-ylidene)ethylidene]-2-chlorocyclohexen-1-yl]ethenyl]-2-methoxy-1,3,3-trimethylindole |
|---|---|
| PubChem CID | 72573641 |
| Molecular Formula | C41H55ClN2O3 |
| Molecular Weight | 659.36 g/mol |
| Exact Mass | 658.39 |
| IUPAC Name | 5-butoxy-2-[2-[3-[2-(5-butoxy-1,3,3-trimethylindol-2-ylidene)ethylidene]-2-chlorocyclohexen-1-yl]ethenyl]-2-methoxy-1,3,3-trimethylindole |
| SMILES | CCCCOc1ccc2c(c1)C(C)(C)C(=CC=C1CCCC(C=CC3(OC)N(C)c4ccc(OCCCC)cc4C3(C)C)=C1Cl)N2C |
| InChI | InChI=1S/C41H55ClN2O3/c1-10-12-25-46-31-18-20-35-33(27-31)39(3,4)37(43(35)7)22-17-29-15-14-16-30(38(29)42)23-24-41(45-9)40(5,6)34-28-32(47-26-13-11-2)19-21-36(34)44(41)8/h17-24,27-28H,10-16,25-26H2,1-9H3 |
| InChIKey | NELDQWYLUQHETC-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.36 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|