C45H63ClN2O — CID 72573634
2-[2-[2-chloro-3-[2-(1,3,3-trimethyl-5,6-dipropylindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-2-methoxy-1,3,3-trimethyl-5,6-dipropylindole (PubChem CID 72573634) has the molecular formula C45H63ClN2O and a molecular weight of 683.47 g/mol. Its IUPAC name is 2-[2-[2-chloro-3-[2-(1,3,3-trimethyl-5,6-dipropylindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-2-methoxy-1,3,3-trimethyl-5,6-dipropylindole.
| Compound Name | 2-[2-[2-chloro-3-[2-(1,3,3-trimethyl-5,6-dipropylindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-2-methoxy-1,3,3-trimethyl-5,6-dipropylindole |
|---|---|
| PubChem CID | 72573634 |
| Molecular Formula | C45H63ClN2O |
| Molecular Weight | 683.47 g/mol |
| Exact Mass | 682.46 |
| IUPAC Name | 2-[2-[2-chloro-3-[2-(1,3,3-trimethyl-5,6-dipropylindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-2-methoxy-1,3,3-trimethyl-5,6-dipropylindole |
| SMILES | CCCc1cc2c(cc1CCC)C(C)(C)C(=CC=C1CCCC(C=CC3(OC)N(C)c4cc(CCC)c(CCC)cc4C3(C)C)=C1Cl)N2C |
| InChI | InChI=1S/C45H63ClN2O/c1-12-17-33-27-37-39(29-35(33)19-14-3)47(9)41(43(37,5)6)24-23-31-21-16-22-32(42(31)46)25-26-45(49-11)44(7,8)38-28-34(18-13-2)36(20-15-4)30-40(38)48(45)10/h23-30H,12-22H2,1-11H3 |
| InChIKey | MOKKRTLTSUQJRZ-UHFFFAOYSA-N |
| XLogP | 12.04 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.47 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |