C43H41N4O4+ — CID 76785083
3-benzyl-2-[9-(3-benzyl-1,3-dimethyl-5-nitroindol-1-ium-2-yl)nona-2,4,6,8-tetraenylidene]-1,3-dimethyl-5-nitroindole (PubChem CID 76785083) has the molecular formula C43H41N4O4+ and a molecular weight of 677.83 g/mol. Its IUPAC name is 3-benzyl-2-[9-(3-benzyl-1,3-dimethyl-5-nitroindol-1-ium-2-yl)nona-2,4,6,8-tetraenylidene]-1,3-dimethyl-5-nitroindole.
| Compound Name | 3-benzyl-2-[9-(3-benzyl-1,3-dimethyl-5-nitroindol-1-ium-2-yl)nona-2,4,6,8-tetraenylidene]-1,3-dimethyl-5-nitroindole |
|---|---|
| PubChem CID | 76785083 |
| Molecular Formula | C43H41N4O4+ |
| Molecular Weight | 677.83 g/mol |
| Exact Mass | 677.31 |
| IUPAC Name | 3-benzyl-2-[9-(3-benzyl-1,3-dimethyl-5-nitroindol-1-ium-2-yl)nona-2,4,6,8-tetraenylidene]-1,3-dimethyl-5-nitroindole |
| SMILES | CN1C(=CC=CC=CC=CC=CC2=[N+](C)c3ccc([N+](=O)[O-])cc3C2(C)Cc2ccccc2)C(C)(Cc2ccccc2)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C43H41N4O4/c1-42(30-32-18-12-10-13-19-32)36-28-34(46(48)49)24-26-38(36)44(3)40(42)22-16-8-6-5-7-9-17-23-41-43(2,31-33-20-14-11-15-21-33)37-29-35(47(50)51)25-27-39(37)45(41)4/h5-29H,30-31H2,1-4H3/q+1 |
| InChIKey | HWPOZBIWADLSIF-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 92.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.83 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|