C45H51N4O4+ — CID 58160789
(2E)-3,3-dibenzyl-2-[(E)-3-[3,3-dimethyl-1-(3-methylbutyl)-5-nitroindol-1-ium-2-yl]prop-2-enylidene]-1-(3-methylbutyl)-5-nitroindole (PubChem CID 58160789) has the molecular formula C45H51N4O4+ and a molecular weight of 711.93 g/mol. Its IUPAC name is (2E)-3,3-dibenzyl-2-[(E)-3-[3,3-dimethyl-1-(3-methylbutyl)-5-nitroindol-1-ium-2-yl]prop-2-enylidene]-1-(3-methylbutyl)-5-nitroindole.
| Compound Name | (2E)-3,3-dibenzyl-2-[(E)-3-[3,3-dimethyl-1-(3-methylbutyl)-5-nitroindol-1-ium-2-yl]prop-2-enylidene]-1-(3-methylbutyl)-5-nitroindole |
|---|---|
| PubChem CID | 58160789 |
| Molecular Formula | C45H51N4O4+ |
| Molecular Weight | 711.93 g/mol |
| Exact Mass | 711.39 |
| IUPAC Name | (2E)-3,3-dibenzyl-2-[(E)-3-[3,3-dimethyl-1-(3-methylbutyl)-5-nitroindol-1-ium-2-yl]prop-2-enylidene]-1-(3-methylbutyl)-5-nitroindole |
| SMILES | CC(C)CCN1/C(=C/C=C/C2=[N+](CCC(C)C)c3ccc([N+](=O)[O-])cc3C2(C)C)C(Cc2ccccc2)(Cc2ccccc2)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C45H51N4O4/c1-32(2)24-26-46-40-22-20-36(48(50)51)28-38(40)44(5,6)42(46)18-13-19-43-45(30-34-14-9-7-10-15-34,31-35-16-11-8-12-17-35)39-29-37(49(52)53)21-23-41(39)47(43)27-25-33(3)4/h7-23,28-29,32-33H,24-27,30-31H2,1-6H3/q+1 |
| InChIKey | PABLTKOCTAINBC-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 92.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.93 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|