C27H32N3O3+ — CID 162275101
2-[3-[3,3-dimethyl-1-(3-methylbutyl)-5-nitroindol-2-ylidene]prop-1-enyl]-3-ethyl-1,3-benzoxazol-3-ium (PubChem CID 162275101) has the molecular formula C27H32N3O3+ and a molecular weight of 446.57 g/mol. Its IUPAC name is 2-[3-[3,3-dimethyl-1-(3-methylbutyl)-5-nitroindol-2-ylidene]prop-1-enyl]-3-ethyl-1,3-benzoxazol-3-ium.
| Compound Name | 2-[3-[3,3-dimethyl-1-(3-methylbutyl)-5-nitroindol-2-ylidene]prop-1-enyl]-3-ethyl-1,3-benzoxazol-3-ium |
|---|---|
| PubChem CID | 162275101 |
| Molecular Formula | C27H32N3O3+ |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 2-[3-[3,3-dimethyl-1-(3-methylbutyl)-5-nitroindol-2-ylidene]prop-1-enyl]-3-ethyl-1,3-benzoxazol-3-ium |
| SMILES | CC[n+]1c(C=CC=C2N(CCC(C)C)c3ccc([N+](=O)[O-])cc3C2(C)C)oc2ccccc21 |
| InChI | InChI=1S/C27H32N3O3/c1-6-28-23-10-7-8-11-24(23)33-26(28)13-9-12-25-27(4,5)21-18-20(30(31)32)14-15-22(21)29(25)17-16-19(2)3/h7-15,18-19H,6,16-17H2,1-5H3/q+1 |
| InChIKey | BSJXRIAQNCYLME-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 63.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|