C39H36F6N3O3+ — CID 173480486
2-[3-[1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-cyclopenta-2,4-dien-1-ylpropyl)-3-methyl-5-nitroindol-2-ylidene]prop-1-enyl]-3-butyl-1,3-benzoxazol-3-ium (PubChem CID 173480486) has the molecular formula C39H36F6N3O3+ and a molecular weight of 708.72 g/mol. Its IUPAC name is 2-[3-[1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-cyclopenta-2,4-dien-1-ylpropyl)-3-methyl-5-nitroindol-2-ylidene]prop-1-enyl]-3-butyl-1,3-benzoxazol-3-ium.
| Compound Name | 2-[3-[1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-cyclopenta-2,4-dien-1-ylpropyl)-3-methyl-5-nitroindol-2-ylidene]prop-1-enyl]-3-butyl-1,3-benzoxazol-3-ium |
|---|---|
| PubChem CID | 173480486 |
| Molecular Formula | C39H36F6N3O3+ |
| Molecular Weight | 708.72 g/mol |
| Exact Mass | 708.27 |
| IUPAC Name | 2-[3-[1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-cyclopenta-2,4-dien-1-ylpropyl)-3-methyl-5-nitroindol-2-ylidene]prop-1-enyl]-3-butyl-1,3-benzoxazol-3-ium |
| SMILES | CCCC[n+]1c(C=CC=C2N(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c3ccc([N+](=O)[O-])cc3C2(C)CCCC2C=CC=C2)oc2ccccc21 |
| InChI | InChI=1S/C39H36F6N3O3/c1-3-4-21-46-33-14-7-8-15-34(33)51-36(46)17-9-16-35-37(2,20-10-13-26-11-5-6-12-26)31-25-29(48(49)50)18-19-32(31)47(35)30-23-27(38(40,41)42)22-28(24-30)39(43,44)45/h5-9,11-12,14-19,22-26H,3-4,10,13,20-21H2,1-2H3/q+1 |
| InChIKey | HEESRCKBHQXITN-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 63.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.72 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|