C36H31N4O10S+ — CID 74059710
2-[4-[[2-[3-[1-[(3,5-dinitrophenyl)methyl]-3,3-dimethyl-5-(trioxidanylsulfanyl)indol-2-ylidene]prop-1-enyl]-1,3-benzoxazol-3-ium-3-yl]methyl]phenyl]acetic acid (PubChem CID 74059710) has the molecular formula C36H31N4O10S+ and a molecular weight of 711.73 g/mol. Its IUPAC name is 2-[4-[[2-[3-[1-[(3,5-dinitrophenyl)methyl]-3,3-dimethyl-5-(trioxidanylsulfanyl)indol-2-ylidene]prop-1-enyl]-1,3-benzoxazol-3-ium-3-yl]methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[[2-[3-[1-[(3,5-dinitrophenyl)methyl]-3,3-dimethyl-5-(trioxidanylsulfanyl)indol-2-ylidene]prop-1-enyl]-1,3-benzoxazol-3-ium-3-yl]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 74059710 |
| Molecular Formula | C36H31N4O10S+ |
| Molecular Weight | 711.73 g/mol |
| Exact Mass | 711.18 |
| IUPAC Name | 2-[4-[[2-[3-[1-[(3,5-dinitrophenyl)methyl]-3,3-dimethyl-5-(trioxidanylsulfanyl)indol-2-ylidene]prop-1-enyl]-1,3-benzoxazol-3-ium-3-yl]methyl]phenyl]acetic acid |
| SMILES | CC1(C)C(=CC=Cc2oc3ccccc3[n+]2Cc2ccc(CC(=O)O)cc2)N(Cc2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c2ccc(SOOO)cc21 |
| InChI | InChI=1S/C36H30N4O10S/c1-36(2)29-20-28(51-50-49-47)14-15-30(29)37(22-25-16-26(39(43)44)19-27(17-25)40(45)46)33(36)8-5-9-34-38(31-6-3-4-7-32(31)48-34)21-24-12-10-23(11-13-24)18-35(41)42/h3-17,19-20H,18,21-22H2,1-2H3,(H-,41,42,47)/p+1 |
| InChIKey | PBESHNLXMWYPIS-UHFFFAOYSA-O |
| XLogP | 7.54 |
| TPSA | 182.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.73 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|