C26H29KN2O5S — CID 161356647
potassium 6-[3,3-dimethyl-2-(4-phenyliminobut-2-enylidene)-5-(trioxidanylsulfanyl)indol-1-yl]hexanoate (PubChem CID 161356647) has the molecular formula C26H29KN2O5S and a molecular weight of 520.69 g/mol. Its IUPAC name is potassium 6-[3,3-dimethyl-2-(4-phenyliminobut-2-enylidene)-5-(trioxidanylsulfanyl)indol-1-yl]hexanoate.
| Compound Name | potassium 6-[3,3-dimethyl-2-(4-phenyliminobut-2-enylidene)-5-(trioxidanylsulfanyl)indol-1-yl]hexanoate |
|---|---|
| PubChem CID | 161356647 |
| Molecular Formula | C26H29KN2O5S |
| Molecular Weight | 520.69 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | potassium 6-[3,3-dimethyl-2-(4-phenyliminobut-2-enylidene)-5-(trioxidanylsulfanyl)indol-1-yl]hexanoate |
| SMILES | CC1(C)C(=CC=C/C=N/c2ccccc2)N(CCCCCC(=O)[O-])c2ccc(SOOO)cc21.[K+] |
| InChI | InChI=1S/C26H30N2O5S.K/c1-26(2)22-19-21(34-33-32-31)15-16-23(22)28(18-10-4-7-14-25(29)30)24(26)13-8-9-17-27-20-11-5-3-6-12-20;/h3,5-6,8-9,11-13,15-17,19,31H,4,7,10,14,18H2,1-2H3,(H,29,30);/q;+1/p-1/b9-8?,24-13?,27-17+; |
| InChIKey | RRJYRYAMXVVENH-MXRJKMFKSA-M |
| XLogP | 2.37 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.69 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|