C25H30N2O6S2 — CID 59381206
4-[(2E)-1-ethyl-3-methyl-2-[(E)-4-phenyliminobut-2-enylidene]-5-(trioxidanylsulfanyl)indol-3-yl]butane-1-sulfonic acid (PubChem CID 59381206) has the molecular formula C25H30N2O6S2 and a molecular weight of 518.66 g/mol. Its IUPAC name is 4-[(2E)-1-ethyl-3-methyl-2-[(E)-4-phenyliminobut-2-enylidene]-5-(trioxidanylsulfanyl)indol-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[(2E)-1-ethyl-3-methyl-2-[(E)-4-phenyliminobut-2-enylidene]-5-(trioxidanylsulfanyl)indol-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 59381206 |
| Molecular Formula | C25H30N2O6S2 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 4-[(2E)-1-ethyl-3-methyl-2-[(E)-4-phenyliminobut-2-enylidene]-5-(trioxidanylsulfanyl)indol-3-yl]butane-1-sulfonic acid |
| SMILES | CCN1/C(=C/C=C/C=N/c2ccccc2)C(C)(CCCCS(=O)(=O)O)c2cc(SOOO)ccc21 |
| InChI | InChI=1S/C25H30N2O6S2/c1-3-27-23-15-14-21(34-33-32-28)19-22(23)25(2,16-8-10-18-35(29,30)31)24(27)13-7-9-17-26-20-11-5-4-6-12-20/h4-7,9,11-15,17,19,28H,3,8,10,16,18H2,1-2H3,(H,29,30,31)/b9-7+,24-13+,26-17+ |
| InChIKey | PAYHXHMMODVUKU-AHOAXFQSSA-N |
| XLogP | 6.11 |
| TPSA | 108.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|