C27H35N2O9S3+ — CID 88553596
4-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3-methyl-5-(trioxidanylsulfanyl)-1-[4-(trioxidanylsulfanyl)butyl]indol-1-ium-3-yl]butane-1-sulfonic acid (PubChem CID 88553596) has the molecular formula C27H35N2O9S3+ and a molecular weight of 627.78 g/mol. Its IUPAC name is 4-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3-methyl-5-(trioxidanylsulfanyl)-1-[4-(trioxidanylsulfanyl)butyl]indol-1-ium-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3-methyl-5-(trioxidanylsulfanyl)-1-[4-(trioxidanylsulfanyl)butyl]indol-1-ium-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 88553596 |
| Molecular Formula | C27H35N2O9S3+ |
| Molecular Weight | 627.78 g/mol |
| Exact Mass | 627.15 |
| IUPAC Name | 4-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3-methyl-5-(trioxidanylsulfanyl)-1-[4-(trioxidanylsulfanyl)butyl]indol-1-ium-3-yl]butane-1-sulfonic acid |
| SMILES | CC1(CCCCS(=O)(=O)O)C(/C=C/C=C/Nc2ccccc2)=[N+](CCCCSOOO)c2ccc(SOOO)cc21 |
| InChI | InChI=1S/C27H34N2O9S3/c1-27(16-6-10-20-41(32,33)34)24-21-23(40-38-36-31)14-15-25(24)29(18-8-9-19-39-37-35-30)26(27)13-5-7-17-28-22-11-3-2-4-12-22/h2-5,7,11-15,17,21H,6,8-10,16,18-20H2,1H3,(H3,30,31,32,33,34)/p+1 |
| InChIKey | BQQACNBYFLCLOS-UHFFFAOYSA-O |
| XLogP | 6.56 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.78 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|