C22H27N2O6S2+ — CID 59238051
2-[(E)-2-anilinoethenyl]-1-ethyl-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonic acid (PubChem CID 59238051) has the molecular formula C22H27N2O6S2+ and a molecular weight of 479.60 g/mol. Its IUPAC name is 2-[(E)-2-anilinoethenyl]-1-ethyl-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonic acid.
| Compound Name | 2-[(E)-2-anilinoethenyl]-1-ethyl-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonic acid |
|---|---|
| PubChem CID | 59238051 |
| Molecular Formula | C22H27N2O6S2+ |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 2-[(E)-2-anilinoethenyl]-1-ethyl-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonic acid |
| SMILES | CC[N+]1=C(/C=C/Nc2ccccc2)C(C)(CCCS(=O)(=O)O)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C22H26N2O6S2/c1-3-24-20-11-10-18(32(28,29)30)16-19(20)22(2,13-7-15-31(25,26)27)21(24)12-14-23-17-8-5-4-6-9-17/h4-6,8-12,14,16H,3,7,13,15H2,1-2H3,(H2,25,26,27,28,29,30)/p+1 |
| InChIKey | GCGYIZSQNSCPMG-UHFFFAOYSA-O |
| XLogP | 3.60 |
| TPSA | 123.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|