C24H29N2O6S2+ — CID 90867089
1-ethyl-3-methyl-2-(4-phenyliminobut-1-enyl)-3-(3-sulfopropyl)indol-1-ium-5-sulfonic acid (PubChem CID 90867089) has the molecular formula C24H29N2O6S2+ and a molecular weight of 505.64 g/mol. Its IUPAC name is 1-ethyl-3-methyl-2-(4-phenyliminobut-1-enyl)-3-(3-sulfopropyl)indol-1-ium-5-sulfonic acid.
| Compound Name | 1-ethyl-3-methyl-2-(4-phenyliminobut-1-enyl)-3-(3-sulfopropyl)indol-1-ium-5-sulfonic acid |
|---|---|
| PubChem CID | 90867089 |
| Molecular Formula | C24H29N2O6S2+ |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 1-ethyl-3-methyl-2-(4-phenyliminobut-1-enyl)-3-(3-sulfopropyl)indol-1-ium-5-sulfonic acid |
| SMILES | CC[N+]1=C(C=CC/C=N/c2ccccc2)C(C)(CCCS(=O)(=O)O)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C24H28N2O6S2/c1-3-26-22-14-13-20(34(30,31)32)18-21(22)24(2,15-9-17-33(27,28)29)23(26)12-7-8-16-25-19-10-5-4-6-11-19/h4-7,10-14,16,18H,3,8-9,15,17H2,1-2H3,(H-,27,28,29,30,31,32)/p+1/b12-7?,25-16+ |
| InChIKey | HGQAFAUGEXXOHT-ZYOHNDSISA-O |
| XLogP | 4.33 |
| TPSA | 124.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|