C18H26NO5S+ — CID 87281775
6-(1-ethyl-2,3-dimethyl-5-sulfoindol-1-ium-3-yl)hexanoic acid (PubChem CID 87281775) has the molecular formula C18H26NO5S+ and a molecular weight of 368.48 g/mol. Its IUPAC name is 6-(1-ethyl-2,3-dimethyl-5-sulfoindol-1-ium-3-yl)hexanoic acid.
| Compound Name | 6-(1-ethyl-2,3-dimethyl-5-sulfoindol-1-ium-3-yl)hexanoic acid |
|---|---|
| PubChem CID | 87281775 |
| Molecular Formula | C18H26NO5S+ |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 6-(1-ethyl-2,3-dimethyl-5-sulfoindol-1-ium-3-yl)hexanoic acid |
| SMILES | CC[N+]1=C(C)C(C)(CCCCCC(=O)O)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C18H25NO5S/c1-4-19-13(2)18(3,11-7-5-6-8-17(20)21)15-12-14(25(22,23)24)9-10-16(15)19/h9-10,12H,4-8,11H2,1-3H3,(H-,20,21,22,23,24)/p+1 |
| InChIKey | NUSQVIHAZGFJOK-UHFFFAOYSA-O |
| XLogP | 3.36 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|