C17H24NO4S+ — CID 88957746
1,2,3-trimethyl-3-(6-oxohexyl)indol-1-ium-5-sulfonic acid (PubChem CID 88957746) has the molecular formula C17H24NO4S+ and a molecular weight of 338.45 g/mol. Its IUPAC name is 1,2,3-trimethyl-3-(6-oxohexyl)indol-1-ium-5-sulfonic acid.
| Compound Name | 1,2,3-trimethyl-3-(6-oxohexyl)indol-1-ium-5-sulfonic acid |
|---|---|
| PubChem CID | 88957746 |
| Molecular Formula | C17H24NO4S+ |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1,2,3-trimethyl-3-(6-oxohexyl)indol-1-ium-5-sulfonic acid |
| SMILES | CC1=[N+](C)c2ccc(S(=O)(=O)O)cc2C1(C)CCCCCC=O |
| InChI | InChI=1S/C17H23NO4S/c1-13-17(2,10-6-4-5-7-11-19)15-12-14(23(20,21)22)8-9-16(15)18(13)3/h8-9,11-12H,4-7,10H2,1-3H3/p+1 |
| InChIKey | XVGOQNXOOHJKLP-UHFFFAOYSA-O |
| XLogP | 3.09 |
| TPSA | 74.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|