C17H23NNaO8S2 — CID 87497882
3-(3-carboxypropyl)-2,3-dimethyl-5-sulfonato-1-(3-sulfopropyl)-3H-indolium sodium salt (PubChem CID 87497882) has the molecular formula C17H23NNaO8S2 and a molecular weight of 456.49 g/mol.
| Compound Name | 3-(3-carboxypropyl)-2,3-dimethyl-5-sulfonato-1-(3-sulfopropyl)-3H-indolium sodium salt |
|---|---|
| PubChem CID | 87497882 |
| Molecular Formula | C17H23NNaO8S2 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | — |
| SMILES | CC1=[N+](CCCS(=O)(=O)O)c2ccc(S(=O)(=O)[O-])cc2C1(C)CCCC(=O)O.[Na] |
| InChI | InChI=1S/C17H23NO8S2.Na/c1-12-17(2,8-3-5-16(19)20)14-11-13(28(24,25)26)6-7-15(14)18(12)9-4-10-27(21,22)23;/h6-7,11H,3-5,8-10H2,1-2H3,(H2-,19,20,21,22,23,24,25,26); |
| InChIKey | GWMJBFGQRRCVQW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 151.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|