C23H29NO11S3 — CID 59855473
1-(5-carboxypentyl)-1,2-dimethyl-8-sulfo-3-(3-sulfopropyl)benzo[e]indol-3-ium-6-sulfonate (PubChem CID 59855473) has the molecular formula C23H29NO11S3 and a molecular weight of 591.68 g/mol. Its IUPAC name is 1-(5-carboxypentyl)-1,2-dimethyl-8-sulfo-3-(3-sulfopropyl)benzo[e]indol-3-ium-6-sulfonate.
| Compound Name | 1-(5-carboxypentyl)-1,2-dimethyl-8-sulfo-3-(3-sulfopropyl)benzo[e]indol-3-ium-6-sulfonate |
|---|---|
| PubChem CID | 59855473 |
| Molecular Formula | C23H29NO11S3 |
| Molecular Weight | 591.68 g/mol |
| Exact Mass | 591.09 |
| IUPAC Name | 1-(5-carboxypentyl)-1,2-dimethyl-8-sulfo-3-(3-sulfopropyl)benzo[e]indol-3-ium-6-sulfonate |
| SMILES | CC1=[N+](CCCS(=O)(=O)O)c2ccc3c(S(=O)(=O)[O-])cc(S(=O)(=O)O)cc3c2C1(C)CCCCCC(=O)O |
| InChI | InChI=1S/C23H29NO11S3/c1-15-23(2,10-5-3-4-7-21(25)26)22-18-13-16(37(30,31)32)14-20(38(33,34)35)17(18)8-9-19(22)24(15)11-6-12-36(27,28)29/h8-9,13-14H,3-7,10-12H2,1-2H3,(H3-,25,26,27,28,29,30,31,32,33,34,35) |
| InChIKey | SKIPRCRIHDJKQV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 206.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.68 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|