C22H31F3NO5S+ — CID 143619374
6-[2,3,6-trimethyl-3-(4-sulfobutyl)-4-(trifluoromethyl)indol-1-ium-1-yl]hexanoic acid (PubChem CID 143619374) has the molecular formula C22H31F3NO5S+ and a molecular weight of 478.55 g/mol. Its IUPAC name is 6-[2,3,6-trimethyl-3-(4-sulfobutyl)-4-(trifluoromethyl)indol-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[2,3,6-trimethyl-3-(4-sulfobutyl)-4-(trifluoromethyl)indol-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 143619374 |
| Molecular Formula | C22H31F3NO5S+ |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 6-[2,3,6-trimethyl-3-(4-sulfobutyl)-4-(trifluoromethyl)indol-1-ium-1-yl]hexanoic acid |
| SMILES | CC1=[N+](CCCCCC(=O)O)c2cc(C)cc(C(F)(F)F)c2C1(C)CCCCS(=O)(=O)O |
| InChI | InChI=1S/C22H30F3NO5S/c1-15-13-17(22(23,24)25)20-18(14-15)26(11-7-4-5-9-19(27)28)16(2)21(20,3)10-6-8-12-32(29,30)31/h13-14H,4-12H2,1-3H3,(H-,27,28,29,30,31)/p+1 |
| InChIKey | JYLMEIVTDGAWQN-UHFFFAOYSA-O |
| XLogP | 5.09 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|